C28H34N4O3 — CID 6307814
N'-(4-ethoxyphenyl)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]pyridine-2-carboximidamide (PubChem CID 6307814) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]pyridine-2-carboximidamide.
| Compound Name | N'-(4-ethoxyphenyl)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 6307814 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]pyridine-2-carboximidamide |
| SMILES | CCCCCCOc1ccc(/C=N/N/C(=N/c2ccc(OCC)cc2)c2ccccn2)cc1OC |
| InChI | InChI=1S/C28H34N4O3/c1-4-6-7-10-19-35-26-17-12-22(20-27(26)33-3)21-30-32-28(25-11-8-9-18-29-25)31-23-13-15-24(16-14-23)34-5-2/h8-9,11-18,20-21H,4-7,10,19H2,1-3H3,(H,31,32)/b30-21+ |
| InChIKey | UKNHWJLQTVWYOL-MWAVMZGNSA-N |
| XLogP | 6.15 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|