C12H11Cl2N — CID 18915507
1-(2,4-dichlorophenyl)-N-pent-2-ynylmethanimine (PubChem CID 18915507) has the molecular formula C12H11Cl2N and a molecular weight of 240.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-pent-2-ynylmethanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-pent-2-ynylmethanimine |
|---|---|
| PubChem CID | 18915507 |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-pent-2-ynylmethanimine |
| SMILES | CCC#CC/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N/c1-2-3-4-7-15-9-10-5-6-11(13)8-12(10)14/h5-6,8-9H,2,7H2,1H3/b15-9+ |
| InChIKey | CERYIBPTDFXIIU-OQLLNIDSSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|