C16H23Cl2N — CID 139757285
1-(2,4-dichlorophenyl)-N-nonan-2-ylmethanimine (PubChem CID 139757285) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-nonan-2-ylmethanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-nonan-2-ylmethanimine |
|---|---|
| PubChem CID | 139757285 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-nonan-2-ylmethanimine |
| SMILES | CCCCCCCC(C)/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl2N/c1-3-4-5-6-7-8-13(2)19-12-14-9-10-15(17)11-16(14)18/h9-13H,3-8H2,1-2H3/b19-12+ |
| InChIKey | WULSDWRSBQIJKP-XDHOZWIPSA-N |
| XLogP | 6.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|