C15H18Cl2O — CID 5375578
(E)-1-(2,4-dichlorophenyl)non-1-en-3-one (PubChem CID 5375578) has the molecular formula C15H18Cl2O and a molecular weight of 285.21 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)non-1-en-3-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)non-1-en-3-one |
|---|---|
| PubChem CID | 5375578 |
| Molecular Formula | C15H18Cl2O |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)non-1-en-3-one |
| SMILES | CCCCCCC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2O/c1-2-3-4-5-6-14(18)10-8-12-7-9-13(16)11-15(12)17/h7-11H,2-6H2,1H3/b10-8+ |
| InChIKey | GYUAJPUNRBVZJZ-CSKARUKUSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|