C12H11Cl2NO3 — CID 67802908
1-(2,4-dichlorophenyl)-6-nitrohex-1-en-3-one (PubChem CID 67802908) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-6-nitrohex-1-en-3-one.
| Compound Name | 1-(2,4-dichlorophenyl)-6-nitrohex-1-en-3-one |
|---|---|
| PubChem CID | 67802908 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-6-nitrohex-1-en-3-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)CCC[N+](=O)[O-] |
| InChI | InChI=1S/C12H11Cl2NO3/c13-10-5-3-9(12(14)8-10)4-6-11(16)2-1-7-15(17)18/h3-6,8H,1-2,7H2 |
| InChIKey | KMVXVWACPQWAEM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|