C13H11Cl2NO5 — CID 77003345
2-[carboxymethyl-[3-(2,4-dichlorophenyl)prop-2-enoyl]amino]acetic acid (PubChem CID 77003345) has the molecular formula C13H11Cl2NO5 and a molecular weight of 332.14 g/mol. Its IUPAC name is 2-[carboxymethyl-[3-(2,4-dichlorophenyl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[3-(2,4-dichlorophenyl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 77003345 |
| Molecular Formula | C13H11Cl2NO5 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-[carboxymethyl-[3-(2,4-dichlorophenyl)prop-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)C=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2NO5/c14-9-3-1-8(10(15)5-9)2-4-11(17)16(6-12(18)19)7-13(20)21/h1-5H,6-7H2,(H,18,19)(H,20,21) |
| InChIKey | VTAHGQYTTRIFRX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|