C14H15Cl2NO3 — CID 61008614
3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-ethylamino]propanoic acid (PubChem CID 61008614) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-ethylamino]propanoic acid.
| Compound Name | 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61008614 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)/C=C/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO3/c1-2-17(8-7-14(19)20)13(18)6-3-10-9-11(15)4-5-12(10)16/h3-6,9H,2,7-8H2,1H3,(H,19,20)/b6-3+ |
| InChIKey | XYDSZLUJFYFVJZ-ZZXKWVIFSA-N |
| XLogP | 3.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|