C14H15Cl2NO3 — CID 76896204
methyl 3-[3-(2,5-dichlorophenyl)prop-2-enoyl-methylamino]propanoate (PubChem CID 76896204) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is methyl 3-[3-(2,5-dichlorophenyl)prop-2-enoyl-methylamino]propanoate.
| Compound Name | methyl 3-[3-(2,5-dichlorophenyl)prop-2-enoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 76896204 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | methyl 3-[3-(2,5-dichlorophenyl)prop-2-enoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)C=Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO3/c1-17(8-7-14(19)20-2)13(18)6-3-10-9-11(15)4-5-12(10)16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | PPQONTKCWVZBGT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|