C20H16Cl2O4 — CID 68550268
1-(2,4-dichlorophenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68550268) has the molecular formula C20H16Cl2O4 and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(2,4-dichlorophenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68550268 |
| Molecular Formula | C20H16Cl2O4 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(Cl)cc2Cl)ccc1O |
| InChI | InChI=1S/C20H16Cl2O4/c1-26-20-10-13(3-9-19(20)25)2-7-16(23)12-17(24)8-5-14-4-6-15(21)11-18(14)22/h2-11,25H,12H2,1H3 |
| InChIKey | VMVPPECUXSLCHD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|