C18H15ClO4 — CID 24789062
(E)-1-(2-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)pent-4-ene-1,3-dione (PubChem CID 24789062) has the molecular formula C18H15ClO4 and a molecular weight of 330.77 g/mol. Its IUPAC name is (E)-1-(2-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (E)-1-(2-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 24789062 |
| Molecular Formula | C18H15ClO4 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (E)-1-(2-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)pent-4-ene-1,3-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)c2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C18H15ClO4/c1-23-18-10-12(7-9-16(18)21)6-8-13(20)11-17(22)14-4-2-3-5-15(14)19/h2-10,21H,11H2,1H3/b8-6+ |
| InChIKey | AKBFYXDOGANTDO-SOFGYWHQSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|