C11H6Cl2N4 — CID 2737740
(Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile (PubChem CID 2737740) has the molecular formula C11H6Cl2N4 and a molecular weight of 265.10 g/mol. Its IUPAC name is (Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 2737740 |
| Molecular Formula | C11H6Cl2N4 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile |
| SMILES | N#C/C(N)=C(C#N)/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2N4/c12-8-2-1-7(9(13)3-8)6-17-11(5-15)10(16)4-14/h1-3,6H,16H2/b11-10-,17-6+ |
| InChIKey | URBKTPMIMOJNPL-JWUWQZCUSA-N |
| XLogP | 2.63 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|