C25H34N2O2 — CID 136694434
4-butan-2-yl-2-[[(2S)-2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]propyl]iminomethyl]phenol (PubChem CID 136694434) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-butan-2-yl-2-[[(2S)-2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]propyl]iminomethyl]phenol.
| Compound Name | 4-butan-2-yl-2-[[(2S)-2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]propyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136694434 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-butan-2-yl-2-[[(2S)-2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]propyl]iminomethyl]phenol |
| SMILES | CCC(C)c1ccc(O)c(/C=N/C[C@H](C)/N=C/c2cc(C(C)CC)ccc2O)c1 |
| InChI | InChI=1S/C25H34N2O2/c1-6-17(3)20-8-10-24(28)22(12-20)15-26-14-19(5)27-16-23-13-21(18(4)7-2)9-11-25(23)29/h8-13,15-19,28-29H,6-7,14H2,1-5H3/b26-15+,27-16+/t17?,18?,19-/m0/s1 |
| InChIKey | JBSJSIUFJVQXTL-OXGYENAOSA-N |
| XLogP | 6.05 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|