C28H32N2O2 — CID 137028699
4-butan-2-yl-2-[[2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol (PubChem CID 137028699) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-butan-2-yl-2-[[2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol.
| Compound Name | 4-butan-2-yl-2-[[2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137028699 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 4-butan-2-yl-2-[[2-[(5-butan-2-yl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
| SMILES | CCC(C)c1ccc(O)c(/C=N/c2ccccc2/N=C/c2cc(C(C)CC)ccc2O)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-5-19(3)21-11-13-27(31)23(15-21)17-29-25-9-7-8-10-26(25)30-18-24-16-22(20(4)6-2)12-14-28(24)32/h7-20,31-32H,5-6H2,1-4H3/b29-17+,30-18+ |
| InChIKey | FCGVGHZMVXUVHC-YAGSLNJISA-N |
| XLogP | 7.63 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|