C33H34N2O3 — CID 136729180
(2S)-2-[(2-hydroxyphenyl)methylideneamino]-N-[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]-3-methylbutanamide (PubChem CID 136729180) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxyphenyl)methylideneamino]-N-[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-hydroxyphenyl)methylideneamino]-N-[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 136729180 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (2S)-2-[(2-hydroxyphenyl)methylideneamino]-N-[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](/N=C/c1ccccc1O)C(=O)N[C@@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34N2O3/c1-24(2)31(34-23-26-16-12-13-21-29(26)36)32(37)35-30(22-25-14-6-3-7-15-25)33(38,27-17-8-4-9-18-27)28-19-10-5-11-20-28/h3-21,23-24,30-31,36,38H,22H2,1-2H3,(H,35,37)/b34-23+/t30-,31-/m0/s1 |
| InChIKey | YCYRWIGBGYWHTR-LSNMPZHQSA-N |
| XLogP | 5.50 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|