C13H17FN2O — CID 19700399
2-[(2-fluorophenyl)methylideneamino]-N-(2-methylpropyl)acetamide (PubChem CID 19700399) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylideneamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(2-fluorophenyl)methylideneamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 19700399 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(2-fluorophenyl)methylideneamino]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)C/N=C/c1ccccc1F |
| InChI | InChI=1S/C13H17FN2O/c1-10(2)7-16-13(17)9-15-8-11-5-3-4-6-12(11)14/h3-6,8,10H,7,9H2,1-2H3,(H,16,17)/b15-8+ |
| InChIKey | KRVIPAFHINHXTL-OVCLIPMQSA-N |
| XLogP | 2.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|