C30H28N4 — CID 92529360
(E)-N-[(4R,5S)-3-[(Z)-benzylideneamino]-2-methyl-4,5-diphenylimidazolidin-1-yl]-1-phenylmethanimine (PubChem CID 92529360) has the molecular formula C30H28N4 and a molecular weight of 444.58 g/mol. Its IUPAC name is (E)-N-[(4R,5S)-3-[(Z)-benzylideneamino]-2-methyl-4,5-diphenylimidazolidin-1-yl]-1-phenylmethanimine.
| Compound Name | (E)-N-[(4R,5S)-3-[(Z)-benzylideneamino]-2-methyl-4,5-diphenylimidazolidin-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 92529360 |
| Molecular Formula | C30H28N4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (E)-N-[(4R,5S)-3-[(Z)-benzylideneamino]-2-methyl-4,5-diphenylimidazolidin-1-yl]-1-phenylmethanimine |
| SMILES | CC1N(/N=C\c2ccccc2)[C@H](c2ccccc2)[C@H](c2ccccc2)N1/N=C/c1ccccc1 |
| InChI | InChI=1S/C30H28N4/c1-24-33(31-22-25-14-6-2-7-15-25)29(27-18-10-4-11-19-27)30(28-20-12-5-13-21-28)34(24)32-23-26-16-8-3-9-17-26/h2-24,29-30H,1H3/b31-22-,32-23+/t24?,29-,30+/m1/s1 |
| InChIKey | ZFJQYECGRCXXIO-UWMYTQNWSA-N |
| XLogP | 6.50 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|