C27H22N2 — CID 11014227
N-[(2S,3S)-2,3-diphenylaziridin-1-yl]-1,1-diphenylmethanimine (PubChem CID 11014227) has the molecular formula C27H22N2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[(2S,3S)-2,3-diphenylaziridin-1-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[(2S,3S)-2,3-diphenylaziridin-1-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11014227 |
| Molecular Formula | C27H22N2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[(2S,3S)-2,3-diphenylaziridin-1-yl]-1,1-diphenylmethanimine |
| SMILES | c1ccc(C(=NN2[C@@H](c3ccccc3)[C@@H]2c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)28-29-26(23-17-9-3-10-18-23)27(29)24-19-11-4-12-20-24/h1-20,26-27H/t26-,27-/m0/s1 |
| InChIKey | UZSDQGLXHNCWPC-SVBPBHIXSA-N |
| XLogP | 6.24 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|