C19H21N3O2 — CID 92531275
N-[(2S,3S,5R,6R)-3,5-dimethyl-1-nitroso-2,6-diphenylpiperidin-4-ylidene]hydroxylamine (PubChem CID 92531275) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(2S,3S,5R,6R)-3,5-dimethyl-1-nitroso-2,6-diphenylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[(2S,3S,5R,6R)-3,5-dimethyl-1-nitroso-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 92531275 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(2S,3S,5R,6R)-3,5-dimethyl-1-nitroso-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1/C(=N/O)[C@H](C)[C@H](c2ccccc2)N(N=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2/c1-13-17(20-23)14(2)19(16-11-7-4-8-12-16)22(21-24)18(13)15-9-5-3-6-10-15/h3-14,18-19,23H,1-2H3/b20-17-/t13-,14+,18+,19-/m1/s1 |
| InChIKey | OKZJJNGCIWTGDK-VKZFSABASA-N |
| XLogP | 4.57 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|