C11H13NS — CID 15324830
(3S,4S)-1,3-dimethyl-4-phenylazetidine-2-thione (PubChem CID 15324830) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is (3S,4S)-1,3-dimethyl-4-phenylazetidine-2-thione.
| Compound Name | (3S,4S)-1,3-dimethyl-4-phenylazetidine-2-thione |
|---|---|
| PubChem CID | 15324830 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (3S,4S)-1,3-dimethyl-4-phenylazetidine-2-thione |
| SMILES | C[C@@H]1C(=S)N(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H13NS/c1-8-10(12(2)11(8)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | HYNBBXMGXFKVKP-WPRPVWTQSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|