C14H14N2O5 — CID 15505936
dimethyl (1R,8S,9R,10S)-11-nitroso-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate (PubChem CID 15505936) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is dimethyl (1R,8S,9R,10S)-11-nitroso-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8S,9R,10S)-11-nitroso-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 15505936 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | dimethyl (1R,8S,9R,10S)-11-nitroso-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H]2c3ccccc3[C@H]1N2N=O |
| InChI | InChI=1S/C14H14N2O5/c1-20-13(17)9-10(14(18)21-2)12-8-6-4-3-5-7(8)11(9)16(12)15-19/h3-6,9-12H,1-2H3/t9-,10+,11-,12+ |
| InChIKey | FPIRJQJKNJCKEK-BKUVIOGVSA-N |
| XLogP | 1.36 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|