C25H24O4 — CID 124525436
dimethyl (1S,5S,8S,12S,19R,20R)-hexacyclo[10.6.2.15,8.02,11.04,9.013,18]henicosa-2(11),3,9,13,15,17-hexaene-19,20-dicarboxylate (PubChem CID 124525436) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is dimethyl (1S,5S,8S,12S,19R,20R)-hexacyclo[10.6.2.15,8.02,11.04,9.013,18]henicosa-2(11),3,9,13,15,17-hexaene-19,20-dicarboxylate.
| Compound Name | dimethyl (1S,5S,8S,12S,19R,20R)-hexacyclo[10.6.2.15,8.02,11.04,9.013,18]henicosa-2(11),3,9,13,15,17-hexaene-19,20-dicarboxylate |
|---|---|
| PubChem CID | 124525436 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | dimethyl (1S,5S,8S,12S,19R,20R)-hexacyclo[10.6.2.15,8.02,11.04,9.013,18]henicosa-2(11),3,9,13,15,17-hexaene-19,20-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2c3ccccc3[C@@H](c3cc4c(cc32)[C@H]2CC[C@H]4C2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C25H24O4/c1-28-24(26)22-20-14-5-3-4-6-15(14)21(23(22)25(27)29-2)19-11-17-13-8-7-12(9-13)16(17)10-18(19)20/h3-6,10-13,20-23H,7-9H2,1-2H3/t12-,13-,20-,21-,22+,23+/m0/s1 |
| InChIKey | ZHYBTWFFOHMZBK-LPVZDFLASA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |