C24H26O4 — CID 1101086
dipropan-2-yl (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate (PubChem CID 1101086) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is dipropan-2-yl (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate.
| Compound Name | dipropan-2-yl (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 1101086 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | dipropan-2-yl (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C24H26O4/c1-13(2)27-23(25)21-19-15-9-5-7-11-17(15)20(18-12-8-6-10-16(18)19)22(21)24(26)28-14(3)4/h5-14,19-22H,1-4H3/t19?,20?,21-,22-/m1/s1 |
| InChIKey | ZKNJBXCQPISYDC-LIKPIUCQSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |