C17H16O2 — CID 83985069
methyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate (PubChem CID 83985069) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate.
| Compound Name | methyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate |
|---|---|
| PubChem CID | 83985069 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate |
| SMILES | COC(=O)C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H16O2/c1-19-17(18)16-14-8-4-2-6-12(14)10-11-13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3 |
| InChIKey | KZJDFAPSXCXPSF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |