C17H14O2 — CID 23270818
methyl (11S,13R)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carboxylate (PubChem CID 23270818) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is methyl (11S,13R)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carboxylate.
| Compound Name | methyl (11S,13R)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carboxylate |
|---|---|
| PubChem CID | 23270818 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl (11S,13R)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carboxylate |
| SMILES | COC(=O)C1[C@H]2C3c4cccc5cccc(c45)C3[C@@H]12 |
| InChI | InChI=1S/C17H14O2/c1-19-17(18)16-14-12-9-6-2-4-8-5-3-7-10(11(8)9)13(12)15(14)16/h2-7,12-16H,1H3/t12?,13?,14-,15+,16? |
| InChIKey | VXJJQWOKDGGDOE-OZEOOWDWSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |