C16H16O2 — CID 11053773
methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate (PubChem CID 11053773) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate.
| Compound Name | methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate |
|---|---|
| PubChem CID | 11053773 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)c2cccc3cccc(c23)[C@H]1C |
| InChI | InChI=1S/C16H16O2/c1-10-12-8-4-6-11-7-5-9-13(14(11)12)16(10,2)15(17)18-3/h4-10H,1-3H3/t10-,16-/m1/s1 |
| InChIKey | YNMUKXQJVZKBIM-QLJPJBMISA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |