methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate

C16H16O2 — CID 11053773

IUPACmethyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate
SMILESCOC(=O)[C@@]1(C)c2cccc3cccc(c23)[C@H]1C
InChIInChI=1S/C16H16O2/c1-10-12-8-4-6-11-7-5-9-13(14(11)12)16(10,2)15(17)18-3/h4-10H,1-3H3/t10-,16-/m1/s1
InChIKeyYNMUKXQJVZKBIM-QLJPJBMISA-N
MW240.30 g/mol
LogP3.39
Rot. Bonds1

About methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate

methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate (PubChem CID 11053773) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate.

Molecular Properties

Compound Namemethyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate
PubChem CID11053773
Molecular FormulaC16H16O2
Molecular Weight240.30 g/mol
Exact Mass240.12
IUPAC Namemethyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate
SMILESCOC(=O)[C@@]1(C)c2cccc3cccc(c23)[C@H]1C
InChIInChI=1S/C16H16O2/c1-10-12-8-4-6-11-7-5-9-13(14(11)12)16(10,2)15(17)18-3/h4-10H,1-3H3/t10-,16-/m1/s1
InChIKeyYNMUKXQJVZKBIM-QLJPJBMISA-N
XLogP3.39
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 53.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate?
The IUPAC name of methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate (CID 11053773) is methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate.
What is the SMILES notation for methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate?
The canonical SMILES for methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate is COC(=O)[C@@]1(C)c2cccc3cccc(c23)[C@H]1C.
What is the InChIKey of methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate?
The InChIKey is YNMUKXQJVZKBIM-QLJPJBMISA-N. The full InChI is InChI=1S/C16H16O2/c1-10-12-8-4-6-11-7-5-9-13(14(11)12)16(10,2)15(17)18-3/h4-10H,1-3H3/t10-,16-/m1/s1.
What are the key properties of methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate?
methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate has a molecular weight of 240.30 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R,2R)-1,2-dimethyl-2H-acenaphthylene-1-carboxylate is sourced from PubChem (CID 11053773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).