C19H21N3O — CID 40531961
(2S)-3-[(Z)-benzylideneamino]-2-phenyl-1-propan-2-ylimidazolidin-4-one (PubChem CID 40531961) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (2S)-3-[(Z)-benzylideneamino]-2-phenyl-1-propan-2-ylimidazolidin-4-one.
| Compound Name | (2S)-3-[(Z)-benzylideneamino]-2-phenyl-1-propan-2-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 40531961 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S)-3-[(Z)-benzylideneamino]-2-phenyl-1-propan-2-ylimidazolidin-4-one |
| SMILES | CC(C)N1CC(=O)N(/N=C\c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21N3O/c1-15(2)21-14-18(23)22(19(21)17-11-7-4-8-12-17)20-13-16-9-5-3-6-10-16/h3-13,15,19H,14H2,1-2H3/b20-13-/t19-/m0/s1 |
| InChIKey | LSVZDXSDYBCYDM-KYYPIKSYSA-N |
| XLogP | 3.27 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|