C25H21N3O5 — CID 94846815
4-[(Z)-[(2S)-3-benzyl-2-(4-carboxyphenyl)-5-oxoimidazolidin-1-yl]iminomethyl]benzoic acid (PubChem CID 94846815) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[(Z)-[(2S)-3-benzyl-2-(4-carboxyphenyl)-5-oxoimidazolidin-1-yl]iminomethyl]benzoic acid.
| Compound Name | 4-[(Z)-[(2S)-3-benzyl-2-(4-carboxyphenyl)-5-oxoimidazolidin-1-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 94846815 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[(Z)-[(2S)-3-benzyl-2-(4-carboxyphenyl)-5-oxoimidazolidin-1-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N\N2C(=O)CN(Cc3ccccc3)[C@@H]2c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c29-22-16-27(15-18-4-2-1-3-5-18)23(19-10-12-21(13-11-19)25(32)33)28(22)26-14-17-6-8-20(9-7-17)24(30)31/h1-14,23H,15-16H2,(H,30,31)(H,32,33)/b26-14-/t23-/m0/s1 |
| InChIKey | CECPWYHEOFTFHZ-KLNAUVTNSA-N |
| XLogP | 3.46 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|