C24H23N3O — CID 129440112
(2R)-1-benzyl-2-phenyl-3-(1-phenylethylideneamino)imidazolidin-4-one (PubChem CID 129440112) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (2R)-1-benzyl-2-phenyl-3-(1-phenylethylideneamino)imidazolidin-4-one.
| Compound Name | (2R)-1-benzyl-2-phenyl-3-(1-phenylethylideneamino)imidazolidin-4-one |
|---|---|
| PubChem CID | 129440112 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R)-1-benzyl-2-phenyl-3-(1-phenylethylideneamino)imidazolidin-4-one |
| SMILES | CC(=NN1C(=O)CN(Cc2ccccc2)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O/c1-19(21-13-7-3-8-14-21)25-27-23(28)18-26(17-20-11-5-2-6-12-20)24(27)22-15-9-4-10-16-22/h2-16,24H,17-18H2,1H3/t24-/m1/s1 |
| InChIKey | QRJLQDRKHPOTRV-XMMPIXPASA-N |
| XLogP | 4.45 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|