C26H26ClN3O3 — CID 94846835
(2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4-dimethoxyphenyl)imidazolidin-4-one (PubChem CID 94846835) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4-dimethoxyphenyl)imidazolidin-4-one.
| Compound Name | (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4-dimethoxyphenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 94846835 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4-dimethoxyphenyl)imidazolidin-4-one |
| SMILES | COc1ccc([C@H]2N(Cc3ccccc3)CC(=O)N2/N=C(/C)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H26ClN3O3/c1-18(20-9-11-21(27)12-10-20)28-30-25(31)17-29(16-19-7-5-4-6-8-19)26(30)23-14-13-22(32-2)15-24(23)33-3/h4-15,26H,16-17H2,1-3H3/b28-18-/t26-/m0/s1 |
| InChIKey | VGXASTPWJQCIQI-ZABXAGCJSA-N |
| XLogP | 5.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|