C28H24ClN3O — CID 94846821
(2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-naphthalen-1-ylimidazolidin-4-one (PubChem CID 94846821) has the molecular formula C28H24ClN3O and a molecular weight of 453.97 g/mol. Its IUPAC name is (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-naphthalen-1-ylimidazolidin-4-one.
| Compound Name | (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-naphthalen-1-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 94846821 |
| Molecular Formula | C28H24ClN3O |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (2S)-1-benzyl-3-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-naphthalen-1-ylimidazolidin-4-one |
| SMILES | C/C(=N/N1C(=O)CN(Cc2ccccc2)[C@@H]1c1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24ClN3O/c1-20(22-14-16-24(29)17-15-22)30-32-27(33)19-31(18-21-8-3-2-4-9-21)28(32)26-13-7-11-23-10-5-6-12-25(23)26/h2-17,28H,18-19H2,1H3/b30-20-/t28-/m0/s1 |
| InChIKey | IJHTXBNNBREJBK-ASYBXRLASA-N |
| XLogP | 6.26 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|