C35H36N2O5 — CID 54179350
4-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(4-formylphenyl)methyl]-5,6-dihydroxy-1,3-diazepan-1-yl]methyl]benzoic acid (PubChem CID 54179350) has the molecular formula C35H36N2O5 and a molecular weight of 564.68 g/mol. Its IUPAC name is 4-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(4-formylphenyl)methyl]-5,6-dihydroxy-1,3-diazepan-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(4-formylphenyl)methyl]-5,6-dihydroxy-1,3-diazepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54179350 |
| Molecular Formula | C35H36N2O5 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 4-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(4-formylphenyl)methyl]-5,6-dihydroxy-1,3-diazepan-1-yl]methyl]benzoic acid |
| SMILES | O=Cc1ccc(CN2CN(Cc3ccc(C(=O)O)cc3)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H36N2O5/c38-23-29-13-11-27(12-14-29)21-36-24-37(22-28-15-17-30(18-16-28)35(41)42)32(20-26-9-5-2-6-10-26)34(40)33(39)31(36)19-25-7-3-1-4-8-25/h1-18,23,31-34,39-40H,19-22,24H2,(H,41,42)/t31-,32-,33+,34+/m1/s1 |
| InChIKey | PARZTXHYKQENSJ-WZJLIZBTSA-N |
| XLogP | 4.42 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|