C23H20N2O2 — CID 11111070
(4S)-4-benzhydryl-3-[(E)-benzylideneamino]-1,3-oxazolidin-2-one (PubChem CID 11111070) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (4S)-4-benzhydryl-3-[(E)-benzylideneamino]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzhydryl-3-[(E)-benzylideneamino]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11111070 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (4S)-4-benzhydryl-3-[(E)-benzylideneamino]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](C(c2ccccc2)c2ccccc2)N1/N=C/c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c26-23-25(24-16-18-10-4-1-5-11-18)21(17-27-23)22(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-16,21-22H,17H2/b24-16+/t21-/m1/s1 |
| InChIKey | HKUIFFPDPUFXDG-KCOUNZPASA-N |
| XLogP | 4.67 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|