C15H14N4O2 — CID 5469638
4-[(E)-benzylideneamino]-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 5469638) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[(E)-benzylideneamino]-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-[(E)-benzylideneamino]-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 5469638 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[(E)-benzylideneamino]-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=c1n(/N=C/c2ccccc2)c(=O)n2n1C1C=CC2CC1 |
| InChI | InChI=1S/C15H14N4O2/c20-14-17(16-10-11-4-2-1-3-5-11)15(21)19-13-7-6-12(8-9-13)18(14)19/h1-7,10,12-13H,8-9H2/b16-10+ |
| InChIKey | CXWIGQCGZYLJJW-MHWRWJLKSA-N |
| XLogP | 1.14 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|