C22H12Cl4N4O3 — CID 10625838
1-[(E)-benzylideneamino]-3,5-bis(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 10625838) has the molecular formula C22H12Cl4N4O3 and a molecular weight of 522.18 g/mol. Its IUPAC name is 1-[(E)-benzylideneamino]-3,5-bis(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(E)-benzylideneamino]-3,5-bis(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10625838 |
| Molecular Formula | C22H12Cl4N4O3 |
| Molecular Weight | 522.18 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 1-[(E)-benzylideneamino]-3,5-bis(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(/N=C/c2ccccc2)c(=O)n(-c2ccc(Cl)c(Cl)c2)c(=O)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H12Cl4N4O3/c23-16-8-6-14(10-18(16)25)28-20(31)29(15-7-9-17(24)19(26)11-15)22(33)30(21(28)32)27-12-13-4-2-1-3-5-13/h1-12H/b27-12+ |
| InChIKey | HZVWIUVOKXFSSB-KKMKTNMSSA-N |
| XLogP | 4.65 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|