C12H11N3O2 — CID 131877466
1-(benzylideneamino)-6-methylpyrimidine-2,4-dione (PubChem CID 131877466) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(benzylideneamino)-6-methylpyrimidine-2,4-dione.
| Compound Name | 1-(benzylideneamino)-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131877466 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(benzylideneamino)-6-methylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)[nH]c(=O)n1N=Cc1ccccc1 |
| InChI | InChI=1S/C12H11N3O2/c1-9-7-11(16)14-12(17)15(9)13-8-10-5-3-2-4-6-10/h2-8H,1H3,(H,14,16,17) |
| InChIKey | FRCMPNNSRGBMAY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|