C17H16N4O — CID 5468848
3-benzyl-4-[(Z)-(4-methylphenyl)methylideneamino]-1H-1,2,4-triazol-5-one (PubChem CID 5468848) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-benzyl-4-[(Z)-(4-methylphenyl)methylideneamino]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-benzyl-4-[(Z)-(4-methylphenyl)methylideneamino]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 5468848 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-benzyl-4-[(Z)-(4-methylphenyl)methylideneamino]-1H-1,2,4-triazol-5-one |
| SMILES | Cc1ccc(/C=N\n2c(Cc3ccccc3)n[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H16N4O/c1-13-7-9-15(10-8-13)12-18-21-16(19-20-17(21)22)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,20,22)/b18-12- |
| InChIKey | XUMDXPONOCRKLE-PDGQHHTCSA-N |
| XLogP | 2.35 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|