C23H17FN4O2S — CID 110520209
[4-[(Z)-(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate (PubChem CID 110520209) has the molecular formula C23H17FN4O2S and a molecular weight of 432.48 g/mol. Its IUPAC name is [4-[(Z)-(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110520209 |
| Molecular Formula | C23H17FN4O2S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [4-[(Z)-(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\n2c(Cc3ccccc3)n[nH]c2=S)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN4O2S/c24-19-10-8-18(9-11-19)22(29)30-20-12-6-17(7-13-20)15-25-28-21(26-27-23(28)31)14-16-4-2-1-3-5-16/h1-13,15H,14H2,(H,27,31)/b25-15- |
| InChIKey | MRKHDSBUQDXSJR-MYYYXRDXSA-N |
| XLogP | 4.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|