C19H17FN4O2S — CID 112538511
[4-[(Z)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate (PubChem CID 112538511) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is [4-[(Z)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 112538511 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [4-[(Z)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 4-fluorobenzoate |
| SMILES | CCCc1n[nH]c(=S)n1/N=C\c1ccc(OC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H17FN4O2S/c1-2-3-17-22-23-19(27)24(17)21-12-13-4-10-16(11-5-13)26-18(25)14-6-8-15(20)9-7-14/h4-12H,2-3H2,1H3,(H,23,27)/b21-12- |
| InChIKey | XAAQVYHKZFWLHG-MTJSOVHGSA-N |
| XLogP | 4.13 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|