C14H18N4O — CID 5468811
4-[(E)-benzylideneamino]-3-(3-methylbutyl)-1H-1,2,4-triazol-5-one (PubChem CID 5468811) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-[(E)-benzylideneamino]-3-(3-methylbutyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[(E)-benzylideneamino]-3-(3-methylbutyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 5468811 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-[(E)-benzylideneamino]-3-(3-methylbutyl)-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)CCc1n[nH]c(=O)n1/N=C/c1ccccc1 |
| InChI | InChI=1S/C14H18N4O/c1-11(2)8-9-13-16-17-14(19)18(13)15-10-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H,17,19)/b15-10+ |
| InChIKey | WBFPWFFAZYWBPJ-XNTDXEJSSA-N |
| XLogP | 2.04 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|