C12H12N4O — CID 3861874
4-(cinnamylideneamino)-3-methyl-1H-1,2,4-triazol-5-one (PubChem CID 3861874) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-(cinnamylideneamino)-3-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(cinnamylideneamino)-3-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 3861874 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(cinnamylideneamino)-3-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cc1n[nH]c(=O)n1N=CC=Cc1ccccc1 |
| InChI | InChI=1S/C12H12N4O/c1-10-14-15-12(17)16(10)13-9-5-8-11-6-3-2-4-7-11/h2-9H,1H3,(H,15,17) |
| InChIKey | JKJXLSGFAVLZOT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|