About 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one
4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one (PubChem CID 54028813) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one |
| PubChem CID | 54028813 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C(C)C)c(=O)n1N=CC=Cc1ccccc1 |
| InChI | InChI=1S/C16H18N4OS/c1-12(2)14-15(21)20(16(22-3)19-18-14)17-11-7-10-13-8-5-4-6-9-13/h4-12H,1-3H3 |
| InChIKey | LECPBKBYKMVUDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one?
The IUPAC name of 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one (CID 54028813) is 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one.
What is the SMILES notation for 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one?
The canonical SMILES for 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one is CSc1nnc(C(C)C)c(=O)n1N=CC=Cc1ccccc1.
What is the InChIKey of 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one?
The InChIKey is LECPBKBYKMVUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS/c1-12(2)14-15(21)20(16(22-3)19-18-14)17-11-7-10-13-8-5-4-6-9-13/h4-12H,1-3H3.
What are the key properties of 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one?
4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one has a molecular weight of 314.41 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one is sourced from PubChem (CID 54028813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).