C16H18N4OS — CID 54028813
4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one (PubChem CID 54028813) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one.
| Compound Name | 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 54028813 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-(cinnamylideneamino)-3-methylsulfanyl-6-propan-2-yl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C(C)C)c(=O)n1N=CC=Cc1ccccc1 |
| InChI | InChI=1S/C16H18N4OS/c1-12(2)14-15(21)20(16(22-3)19-18-14)17-11-7-10-13-8-5-4-6-9-13/h4-12H,1-3H3 |
| InChIKey | LECPBKBYKMVUDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|