C11H9ClN4O2 — CID 6026682
4-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-2H-1,2,4-triazine-3,5-dione (PubChem CID 6026682) has the molecular formula C11H9ClN4O2 and a molecular weight of 264.67 g/mol. Its IUPAC name is 4-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 4-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 6026682 |
| Molecular Formula | C11H9ClN4O2 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-2H-1,2,4-triazine-3,5-dione |
| SMILES | Cc1n[nH]c(=O)n(/N=C\c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C11H9ClN4O2/c1-7-10(17)16(11(18)15-14-7)13-6-8-2-4-9(12)5-3-8/h2-6H,1H3,(H,15,18)/b13-6- |
| InChIKey | NBMGTDOMKUYCRF-MLPAPPSSSA-N |
| XLogP | 0.78 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|