C23H20N4 — CID 15499601
(E)-N-[3,5-bis(3-methylphenyl)-1,2,4-triazol-4-yl]-1-phenylmethanimine (PubChem CID 15499601) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (E)-N-[3,5-bis(3-methylphenyl)-1,2,4-triazol-4-yl]-1-phenylmethanimine.
| Compound Name | (E)-N-[3,5-bis(3-methylphenyl)-1,2,4-triazol-4-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 15499601 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (E)-N-[3,5-bis(3-methylphenyl)-1,2,4-triazol-4-yl]-1-phenylmethanimine |
| SMILES | Cc1cccc(-c2nnc(-c3cccc(C)c3)n2/N=C/c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4/c1-17-8-6-12-20(14-17)22-25-26-23(21-13-7-9-18(2)15-21)27(22)24-16-19-10-4-3-5-11-19/h3-16H,1-2H3/b24-16+ |
| InChIKey | JJMSETAJCRXCJP-LFVJCYFKSA-N |
| XLogP | 5.11 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|