C17H16N4O — CID 3242741
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenoxyphenyl)methanimine (PubChem CID 3242741) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenoxyphenyl)methanimine.
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3242741 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenoxyphenyl)methanimine |
| SMILES | Cc1nnc(C)n1N=Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H16N4O/c1-13-19-20-14(2)21(13)18-12-15-7-6-10-17(11-15)22-16-8-4-3-5-9-16/h3-12H,1-2H3 |
| InChIKey | CSPGMDKBWZOPIE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|