C17H15N5 — CID 172916281
(E)-N-[4-[(E)-benzylideneamino]-5-methyl-1,2,4-triazol-3-yl]-1-phenylmethanimine (PubChem CID 172916281) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is (E)-N-[4-[(E)-benzylideneamino]-5-methyl-1,2,4-triazol-3-yl]-1-phenylmethanimine.
| Compound Name | (E)-N-[4-[(E)-benzylideneamino]-5-methyl-1,2,4-triazol-3-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 172916281 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E)-N-[4-[(E)-benzylideneamino]-5-methyl-1,2,4-triazol-3-yl]-1-phenylmethanimine |
| SMILES | Cc1nnc(N=Cc2ccccc2)n1/N=C/c1ccccc1 |
| InChI | InChI=1S/C17H15N5/c1-14-20-21-17(18-12-15-8-4-2-5-9-15)22(14)19-13-16-10-6-3-7-11-16/h2-13H,1H3/b18-12?,19-13+ |
| InChIKey | CFZPSHXWTQXNIA-QFXLRJOESA-N |
| XLogP | 3.22 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|