C11H11N7O — CID 4157322
N-(3-azido-5-methyl-1,2,4-triazol-4-yl)-1-(4-methoxyphenyl)methanimine (PubChem CID 4157322) has the molecular formula C11H11N7O and a molecular weight of 257.26 g/mol. Its IUPAC name is N-(3-azido-5-methyl-1,2,4-triazol-4-yl)-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-(3-azido-5-methyl-1,2,4-triazol-4-yl)-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4157322 |
| Molecular Formula | C11H11N7O |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(3-azido-5-methyl-1,2,4-triazol-4-yl)-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(C=Nn2c(C)nnc2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C11H11N7O/c1-8-14-15-11(16-17-12)18(8)13-7-9-3-5-10(19-2)6-4-9/h3-7H,1-2H3 |
| InChIKey | JNQWDXHIEXSKGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|