C14H19N8+ — CID 73253745
(E)-[4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-yl]imino-iminoazanium (PubChem CID 73253745) has the molecular formula C14H19N8+ and a molecular weight of 299.36 g/mol. Its IUPAC name is (E)-[4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-yl]imino-iminoazanium.
| Compound Name | (E)-[4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 73253745 |
| Molecular Formula | C14H19N8+ |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (E)-[4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-yl]imino-iminoazanium |
| SMILES | CCN(CC)c1ccc(/C=N/n2c(C)nnc2N=[N+]=N)cc1 |
| InChI | InChI=1S/C14H19N8/c1-4-21(5-2)13-8-6-12(7-9-13)10-16-22-11(3)17-18-14(22)19-20-15/h6-10,15H,4-5H2,1-3H3/q+1/b16-10+ |
| InChIKey | QYIOCGFUNBFSRN-MHWRWJLKSA-N |
| XLogP | 2.50 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|