C20H26N2 — CID 1378244
N,N-diethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline (PubChem CID 1378244) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N,N-diethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline.
| Compound Name | N,N-diethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline |
|---|---|
| PubChem CID | 1378244 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N,N-diethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=N/c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H26N2/c1-6-22(7-2)19-10-8-18(9-11-19)14-21-20-16(4)12-15(3)13-17(20)5/h8-14H,6-7H2,1-5H3/b21-14+ |
| InChIKey | ZHVMRUYBHYYPOZ-KGENOOAVSA-N |
| XLogP | 5.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|