C21H27N3O — CID 126370340
N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(2,5-dimethylphenyl)acetamide (PubChem CID 126370340) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126370340 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(2,5-dimethylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)Cc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H27N3O/c1-5-24(6-2)20-11-9-18(10-12-20)15-22-23-21(25)14-19-13-16(3)7-8-17(19)4/h7-13,15H,5-6,14H2,1-4H3,(H,23,25)/b22-15+ |
| InChIKey | RCWYDDFQIDMEBT-PXLXIMEGSA-N |
| XLogP | 3.84 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|