C32H32N6O — CID 88919689
N,N-diethyl-4-[[3-methyl-4-[[4-[[4-(oxiran-2-yl)phenyl]methylideneamino]phenyl]diazenyl]phenyl]diazenyl]aniline (PubChem CID 88919689) has the molecular formula C32H32N6O and a molecular weight of 516.65 g/mol. Its IUPAC name is N,N-diethyl-4-[[3-methyl-4-[[4-[[4-(oxiran-2-yl)phenyl]methylideneamino]phenyl]diazenyl]phenyl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[3-methyl-4-[[4-[[4-(oxiran-2-yl)phenyl]methylideneamino]phenyl]diazenyl]phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 88919689 |
| Molecular Formula | C32H32N6O |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | N,N-diethyl-4-[[3-methyl-4-[[4-[[4-(oxiran-2-yl)phenyl]methylideneamino]phenyl]diazenyl]phenyl]diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=C/c4ccc(C5CO5)cc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C32H32N6O/c1-4-38(5-2)30-17-14-28(15-18-30)34-36-29-16-19-31(23(3)20-29)37-35-27-12-10-26(11-13-27)33-21-24-6-8-25(9-7-24)32-22-39-32/h6-21,32H,4-5,22H2,1-3H3/b33-21+,36-34+,37-35+ |
| InChIKey | IUPUFYDCOBLPKH-NTDIIHOQSA-N |
| XLogP | 9.49 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|